(S)-2-Amino-2-(3,5-difluorophenyl)ethanol, 95%
cas: 1212932-15-4 — see every product listed under this CAS number, including other names
(S)-2-Amino-2-(3,5-difluorophenyl)ethanol, 95% (CAS 1212932-15-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A232378-250mg |
| cas | 1212932-15-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 731.94 Pln | |
| Ambeed | 1g | 1950.12 Pln | |
| Ambeed | 5g | 6444.62 Pln | |
| Ambeed | 10g | 9409.44 Pln | |
| Ambeed | 25g | 21023.94 Pln | |
| BLDpharm | 100mg | 497.63 Pln | |
| BLDpharm | 250mg | 780.86 Pln | |
| BLDpharm | 1g | 2097.06 Pln | |
| BLDpharm | 5g | 6945.36 Pln | |
| BLDpharm | 10g | 10138.68 Pln | |
| BLDpharm | 25g | 22667.60 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-2-amino-2-(3,5-difluorophenyl)ethanol (CAS 1212932-15-4) is a chemical compound with the molecular formula C8H9F2NO and a molecular weight of 173.16 g/mol. IUPAC name: (2S)-2-amino-2-(3,5-difluorophenyl)ethanol. InChIKey: ROJBFFNJZLJBJI-MRVPVSSYSA-N.
| Molecular formula | C8H9F2NO |
|---|---|
| Molecular weight | 173.16 g/mol |
| IUPAC name | (2S)-2-amino-2-(3,5-difluorophenyl)ethanol |
| InChIKey | ROJBFFNJZLJBJI-MRVPVSSYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)[C@@H](CO)N |
Computed by PubChem (NCBI)