(S)-2-Amino-2-(3,5-difluorophenyl)ethanol, 98%
cas: 1212932-15-4 — see every product listed under this CAS number, including other names
(S)-2-Amino-2-(3,5-difluorophenyl)ethanol, 98% (CAS 1212932-15-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch110Z0R-100mg |
| cas | 1212932-15-4 |
| size | 100mg |
| availability | 20g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 429.20 Pln | |
| Chemat | 250mg | 683.60 Pln | |
| Chemat | 1g | 2397.20 Pln | |
| Chemat | 5g | 8229.20 Pln | |
| Chemat | 10g | 9256.40 Pln | |
| Fluorochem | 250mg | 742.46 Pln | |
| Fluorochem | 1g | 1997.23 Pln | |
| Fluorochem | 5g | 6459.20 Pln | |
| Fluorochem | 10g | 9447.73 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-amino-2-(3,5-difluorophenyl)ethanol (CAS 1212932-15-4) is a chemical compound with the molecular formula C8H9F2NO and a molecular weight of 173.16 g/mol. IUPAC name: (2S)-2-amino-2-(3,5-difluorophenyl)ethanol. InChIKey: ROJBFFNJZLJBJI-MRVPVSSYSA-N.
| Molecular formula | C8H9F2NO |
|---|---|
| Molecular weight | 173.16 g/mol |
| IUPAC name | (2S)-2-amino-2-(3,5-difluorophenyl)ethanol |
| InChIKey | ROJBFFNJZLJBJI-MRVPVSSYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)[C@@H](CO)N |
Computed by PubChem (NCBI)