(S)-2-Amino-2-(3-chlorophenyl)ethanol, 97%
cas: 663611-73-2 — see every product listed under this CAS number, including other names
(S)-2-Amino-2-(3-chlorophenyl)ethanol, 97% (CAS 663611-73-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A148014-250mg |
| cas | 663611-73-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 181.25 Pln | |
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 654.06 Pln | |
| Ambeed | 10g | 1115.75 Pln | |
| Ambeed | 25g | 2422.94 Pln | |
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 1g | 206.20 Pln | |
| Fluorochem | 5g | 664.37 Pln | |
| Fluorochem | 10g | 1138.16 Pln | |
| Fluorochem | 25g | 2486.64 Pln | |
| BLDpharm | 250mg | 169.96 Pln | |
| BLDpharm | 1g | 269.93 Pln | |
| BLDpharm | 5g | 719.77 Pln | |
| BLDpharm | 10g | 1236.26 Pln | |
| BLDpharm | 25g | 2696.85 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-2-amino-2-(3-chlorophenyl)ethanol (CAS 663611-73-2) is a chemical compound with the molecular formula C8H10ClNO and a molecular weight of 171.62 g/mol. IUPAC name: (2S)-2-amino-2-(3-chlorophenyl)ethanol. InChIKey: HLXHAXFWWGYXQW-MRVPVSSYSA-N.
| Molecular formula | C8H10ClNO |
|---|---|
| Molecular weight | 171.62 g/mol |
| IUPAC name | (2S)-2-amino-2-(3-chlorophenyl)ethanol |
| InChIKey | HLXHAXFWWGYXQW-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)[C@@H](CO)N |
Computed by PubChem (NCBI)