cas: 43189-45-3 — see every product listed under this CAS number, including other names
(S)-2-Amino-2-(thiophen-2-yl)acetic acid, 98.0% (CAS 43189-45-3) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 5 g, 100 mg, 500 mg, 250 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W017256-1 g |
| cas | 43189-45-3 |
| size | 1 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 1661.81 Pln | |
| MedChemExpress | 5 g | 3969.88 Pln | |
| MedChemExpress | 100 mg | 477.59 Pln | |
| MedChemExpress | 500 mg | 1085.95 Pln | |
| MedChemExpress | 250 mg | 821.24 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.0% |
(2S)-2-amino-2-thiophen-2-ylacetic acid (CAS 43189-45-3) is a chemical compound with the molecular formula C6H7NO2S and a molecular weight of 157.19 g/mol. IUPAC name: (2S)-2-amino-2-thiophen-2-ylacetic acid. InChIKey: XLMSKXASROPJNG-RXMQYKEDSA-N.
| Molecular formula | C6H7NO2S |
|---|---|
| Molecular weight | 157.19 g/mol |
| IUPAC name | (2S)-2-amino-2-thiophen-2-ylacetic acid |
| InChIKey | XLMSKXASROPJNG-RXMQYKEDSA-N |
| SMILES | C1=CSC(=C1)[C@H](C(=O)O)N |
Computed by PubChem (NCBI)