CAS 43189-45-3 appears in our catalog under these names: (S)-2-Thienylglycine, 98%, (S)–2–Amino–2–(thiophen–2–yl)acetic acid, (S)-2-THIENYLGLYCINE, 98%, 98%, (S)-2-Amino-2-(thiophen-2-yl)acetic acid, 98.0%, (S)-2-Amino-2-(thiophen-2-yl)acetic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 100mg, 250mg, 1 g, 5 g.
(2S)-2-amino-2-thiophen-2-ylacetic acid (CAS 43189-45-3) is a chemical compound with the molecular formula C6H7NO2S and a molecular weight of 157.19 g/mol. IUPAC name: (2S)-2-amino-2-thiophen-2-ylacetic acid. InChIKey: XLMSKXASROPJNG-RXMQYKEDSA-N.
| Molecular formula | C6H7NO2S |
|---|---|
| Molecular weight | 157.19 g/mol |
| IUPAC name | (2S)-2-amino-2-thiophen-2-ylacetic acid |
| InChIKey | XLMSKXASROPJNG-RXMQYKEDSA-N |
| SMILES | C1=CSC(=C1)[C@H](C(=O)O)N |
Computed by PubChem (NCBI)