(S)-2-Amino-4-(2-methoxyphenyl)-4-oxobutanoic acid, 98%
cas: 168154-79-8 — see every product listed under this CAS number, including other names
(S)-2-Amino-4-(2-methoxyphenyl)-4-oxobutanoic acid, 98% (CAS 168154-79-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A2017679-250mg |
| cas | 168154-79-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 3440.88 Pln | |
| Ambeed | 1g | 9170.25 Pln | |
| Chemat | 50mg | 846.80 Pln | |
| Chemat | 100mg | 1394.00 Pln | |
| Chemat | 250mg | 2315.60 Pln | |
| Chemat | 1g | 6141.20 Pln | |
| BLDpharm | 50mg | 1219.60 Pln | |
| BLDpharm | 100mg | 2019.31 Pln | |
| BLDpharm | 250mg | 3379.95 Pln | |
| BLDpharm | 1g | 8989.08 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
(2S)-2-amino-4-(2-methoxyphenyl)-4-oxobutanoic acid (CAS 168154-79-8) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: (2S)-2-amino-4-(2-methoxyphenyl)-4-oxobutanoic acid. InChIKey: SPJHXRHVIFGFCY-QMMMGPOBSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | (2S)-2-amino-4-(2-methoxyphenyl)-4-oxobutanoic acid |
| InChIKey | SPJHXRHVIFGFCY-QMMMGPOBSA-N |
| SMILES | COC1=CC=CC=C1C(=O)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)