Products 1502535-11-6

CAS 1502535-11-6 is the registry number for 8-Methoxy-6-oxo-1,3,4,6-tetrahydro-2h-quinolizine-9-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2-methoxy-4-oxo-6,7,8,9-tetrahydroquinolizine-1-carboxylic acid (CAS 1502535-11-6) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: 2-methoxy-4-oxo-6,7,8,9-tetrahydroquinolizine-1-carboxylic acid. InChIKey: QPJKHWGXFGLRQD-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13NO4
Molecular weight223.22 g/mol
IUPAC name2-methoxy-4-oxo-6,7,8,9-tetrahydroquinolizine-1-carboxylic acid
InChIKeyQPJKHWGXFGLRQD-UHFFFAOYSA-N
SMILESCOC1=CC(=O)N2CCCCC2=C1C(=O)O

Computed by PubChem (NCBI)