cas: 2135301-50-5 — see every product listed under this CAS number, including other names
(S)-2-Amino-5-((S)-3-amino-3-carboxypropanamido)pentanoic acid, 95%, 95% (CAS 2135301-50-5) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1EXR7L-10mg |
| cas | 2135301-50-5 |
| size | 10mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 1163.60 Pln | |
| Chemat | 25mg | 1715.60 Pln | |
| Chemat | 50mg | 2406.80 Pln | |
| Chemat | 100mg | 3232.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-amino-5-[[(3S)-3-amino-3-carboxypropanoyl]amino]pentanoic acid (CAS 2135301-50-5) is a chemical compound with the molecular formula C9H17N3O5 and a molecular weight of 247.25 g/mol. IUPAC name: (2S)-2-amino-5-[[(3S)-3-amino-3-carboxypropanoyl]amino]pentanoic acid. InChIKey: BUNXTVRSILMUMS-WDSKDSINSA-N.
| Molecular formula | C9H17N3O5 |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | (2S)-2-amino-5-[[(3S)-3-amino-3-carboxypropanoyl]amino]pentanoic acid |
| InChIKey | BUNXTVRSILMUMS-WDSKDSINSA-N |
| SMILES | C(C[C@@H](C(=O)O)N)CNC(=O)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)