CAS 2135301-50-5 appears in our catalog under these names: L-Ornithine L-Aspartate Impurity 5, (S)-2-amino-5-((S)-3-amino-3-carboxypropanamido)pentanoic acid, (S)-2-Amino-5-((S)-3-amino-3-carboxypropanamido)pentanoic acid, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg.
(2S)-2-amino-5-[[(3S)-3-amino-3-carboxypropanoyl]amino]pentanoic acid (CAS 2135301-50-5) is a chemical compound with the molecular formula C9H17N3O5 and a molecular weight of 247.25 g/mol. IUPAC name: (2S)-2-amino-5-[[(3S)-3-amino-3-carboxypropanoyl]amino]pentanoic acid. InChIKey: BUNXTVRSILMUMS-WDSKDSINSA-N.
| Molecular formula | C9H17N3O5 |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | (2S)-2-amino-5-[[(3S)-3-amino-3-carboxypropanoyl]amino]pentanoic acid |
| InChIKey | BUNXTVRSILMUMS-WDSKDSINSA-N |
| SMILES | C(C[C@@H](C(=O)O)N)CNC(=O)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)