(S)-2-Phenylpiperidine, 98%
cas: 70665-05-3 — see every product listed under this CAS number, including other names
(S)-2-Phenylpiperidine, 98% (CAS 70665-05-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A422720-250mg |
| cas | 70665-05-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 659.62 Pln | |
| Ambeed | 1g | 1950.12 Pln | |
| Ambeed | 100mg | 414.88 Pln | |
| BLDpharm | 100mg | 442.09 Pln | |
| BLDpharm | 250mg | 647.57 Pln | |
| BLDpharm | 1g | 2097.06 Pln | |
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 496.40 Pln | |
| Chemat | 1g | 1547.60 Pln | |
| Fluorochem | 100mg | 414.46 Pln | |
| Fluorochem | 250mg | 622.72 Pln | |
| Fluorochem | 1g | 1913.93 Pln | |
| Fluorochem | 5g | 7828.51 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-2-phenylpiperidine (CAS 70665-05-3) is a chemical compound with the molecular formula C11H15N and a molecular weight of 161.24 g/mol. IUPAC name: (2S)-2-phenylpiperidine. InChIKey: WGIAUTGOUJDVEI-NSHDSACASA-N.
| Molecular formula | C11H15N |
|---|---|
| Molecular weight | 161.24 g/mol |
| IUPAC name | (2S)-2-phenylpiperidine |
| InChIKey | WGIAUTGOUJDVEI-NSHDSACASA-N |
| SMILES | C1CCN[C@@H](C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)