cas: 361342-52-1 — see every product listed under this CAS number, including other names
(S)-3,3'-BIs(anthracenyl-9-yl)-1,1'-binapthyl-2,2'-diyl hydrogenphosphate 98% (CAS 361342-52-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A610024-50mg |
| cas | 361342-52-1 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 481.62 Pln | |
| Ambeed | 100mg | 576.19 Pln | |
| Ambeed | 250mg | 1176.94 Pln | |
| Ambeed | 1g | 3869.19 Pln | |
| Ambeed | 5g | 13364.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A610024 |
10,16-di(anthracen-9-yl)-13-hydroxy-12,14-dioxa-13lambda5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide (CAS 361342-52-1) is a chemical compound with the molecular formula C48H29O4P and a molecular weight of 700.7 g/mol. IUPAC name: 10,16-di(anthracen-9-yl)-13-hydroxy-12,14-dioxa-13lambda5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide. InChIKey: QYJHYRSRVCOHMY-UHFFFAOYSA-N.
| Molecular formula | C48H29O4P |
|---|---|
| Molecular weight | 700.7 g/mol |
| IUPAC name | 10,16-di(anthracen-9-yl)-13-hydroxy-12,14-dioxa-13lambda5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide |
| InChIKey | QYJHYRSRVCOHMY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C3C=CC=CC3=C2C4=CC5=CC=CC=C5C6=C4OP(=O)(OC7=C6C8=CC=CC=C8C=C7C9=C1C=CC=CC1=CC1=CC=CC=C19)O |
Computed by PubChem (NCBI)