(S)-3,7-Diaminoheptanoic acid dihydrochloride, 95%, 95%
cas: 290835-83-5 — see every product listed under this CAS number, including other names
(S)-3,7-Diaminoheptanoic acid dihydrochloride, 95%, 95% (CAS 290835-83-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BIT8-100mg |
| cas | 290835-83-5 |
| size | 100mg |
| availability | 6g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 525.20 Pln | |
| Chemat | 1g | 1019.60 Pln | |
| Chemat | 5g | 3266.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(3S)-3,7-diaminoheptanoic acid;dihydrochloride (CAS 290835-83-5) is a chemical compound with the molecular formula C7H18Cl2N2O2 and a molecular weight of 233.13 g/mol. IUPAC name: (3S)-3,7-diaminoheptanoic acid;dihydrochloride. InChIKey: APJAFTBCSGCCAH-ILKKLZGPSA-N.
| Molecular formula | C7H18Cl2N2O2 |
|---|---|
| Molecular weight | 233.13 g/mol |
| IUPAC name | (3S)-3,7-diaminoheptanoic acid;dihydrochloride |
| InChIKey | APJAFTBCSGCCAH-ILKKLZGPSA-N |
| SMILES | C(CCN)C[C@@H](CC(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
(3S)-3,7-diaminoheptanoic acid dihydrochloride, (S)-3,7-Diaminoheptanoic acid dihydrochloride, L-beta-Homolysine dihydrochloride, L-beta-homolysine-2HCl, H-b-HoLys-OH.2HCl, L-|A-Homolysine dihydrochloride, L-Beta-homolysine DiHCl, (S)-3,7-Diaminoheptanoicaciddihydrochloride, (3S)-3,7-diaminoheptanoic acid;dihydrochloride, (3S)-3,7-bis(azanyl)heptanoic acid;dihydrochloride