CAS 290835-83-5 appears in our catalog under these names: L-Beta-homolysine dihydrochloride, 98%, L-beta-Homolysine Dihydrochloride, L–Beta–homolysine DiHCl, H-L-beta-HLys-OH*2HCl, L-β-Homolysine dihydrochloride. Offered by: Combi-blocks, TRC, GLPBio, Iris Biotech, Biosynth. Available pack sizes: 250mg, 1g, 25mg, 50mg, 100mg, 5g, 0,25g, 0,5g.
(3S)-3,7-diaminoheptanoic acid;dihydrochloride (CAS 290835-83-5) is a chemical compound with the molecular formula C7H18Cl2N2O2 and a molecular weight of 233.13 g/mol. IUPAC name: (3S)-3,7-diaminoheptanoic acid;dihydrochloride. InChIKey: APJAFTBCSGCCAH-ILKKLZGPSA-N.
| Molecular formula | C7H18Cl2N2O2 |
|---|---|
| Molecular weight | 233.13 g/mol |
| IUPAC name | (3S)-3,7-diaminoheptanoic acid;dihydrochloride |
| InChIKey | APJAFTBCSGCCAH-ILKKLZGPSA-N |
| SMILES | C(CCN)C[C@@H](CC(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)