cas: 500770-79-6 — see every product listed under this CAS number, including other names
(S)-3-((tert-Butoxycarbonyl)amino)-3-(4-(trifluoromethyl)phenyl)propanoic acid, 98%, 98% (CAS 500770-79-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114CN7-1g |
| cas | 500770-79-6 |
| size | 1g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 765.20 Pln | |
| Chemat | 5g | 1451.60 Pln | |
| Chemat | 100mg | 246.80 Pln | |
| Chemat | 250mg | 338.00 Pln | |
| Chemat | 25g | 5046.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(trifluoromethyl)phenyl]propanoic acid (CAS 500770-79-6) is a chemical compound with the molecular formula C15H18F3NO4 and a molecular weight of 333.30 g/mol. IUPAC name: (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(trifluoromethyl)phenyl]propanoic acid. InChIKey: WJMVMQYNFZQHGW-NSHDSACASA-N.
| Molecular formula | C15H18F3NO4 |
|---|---|
| Molecular weight | 333.30 g/mol |
| IUPAC name | (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(trifluoromethyl)phenyl]propanoic acid |
| InChIKey | WJMVMQYNFZQHGW-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)O)C1=CC=C(C=C1)C(F)(F)F |
Computed by PubChem (NCBI)