cas: 297773-45-6 — see every product listed under this CAS number, including other names
(S)-3-((tert-Butoxycarbonyl)amino)-3-(pyridin-3-yl)propanoic acid, 97%, 97% (CAS 297773-45-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114CN3-100mg |
| cas | 297773-45-6 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 299.60 Pln | |
| Chemat | 250mg | 414.80 Pln | |
| Chemat | 1g | 1005.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridin-3-ylpropanoic acid (CAS 297773-45-6) is a chemical compound with the molecular formula C13H18N2O4 and a molecular weight of 266.29 g/mol. IUPAC name: (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridin-3-ylpropanoic acid. InChIKey: GQWRNLFTLLZYBJ-JTQLQIEISA-N.
| Molecular formula | C13H18N2O4 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridin-3-ylpropanoic acid |
| InChIKey | GQWRNLFTLLZYBJ-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)O)C1=CN=CC=C1 |
Computed by PubChem (NCBI)