CAS 500788-96-5 appears in our catalog under these names: Boc-(r)-3-amino-3-(3-pyridyl)-propionic acid, 95%, (R)-N-Boc-3-(3-pyridyl)-beta-alanine, Boc-β-Ala(pyridin-3-yl)-OH, 97%. Offered by: Combi-blocks, Biosynth, Ambeed. Available pack sizes: 5g, 1g, 250mg, 0,5g.
(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridin-3-ylpropanoic acid (CAS 500788-96-5) is a chemical compound with the molecular formula C13H18N2O4 and a molecular weight of 266.29 g/mol. IUPAC name: (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridin-3-ylpropanoic acid. InChIKey: GQWRNLFTLLZYBJ-SNVBAGLBSA-N.
| Molecular formula | C13H18N2O4 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridin-3-ylpropanoic acid |
| InChIKey | GQWRNLFTLLZYBJ-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)O)C1=CN=CC=C1 |
Computed by PubChem (NCBI)