cas: 371240-55-0 — see every product listed under this CAS number, including other names
(S)-3-(Toluene-4-sulfonyloxy)-pyrrolidine-1-carboxylic acid tert-butyl ester 98% (CAS 371240-55-0) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A218926-5g |
| cas | 371240-55-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 1227.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A218926 |
Tert-butyl (3S)-3-(4-methylphenyl)sulfonyloxypyrrolidine-1-carboxylate (CAS 371240-55-0) is a chemical compound with the molecular formula C16H23NO5S and a molecular weight of 341.4 g/mol. IUPAC name: tert-butyl (3S)-3-(4-methylphenyl)sulfonyloxypyrrolidine-1-carboxylate. InChIKey: MWACHFODPQVXHF-ZDUSSCGKSA-N.
| Molecular formula | C16H23NO5S |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | tert-butyl (3S)-3-(4-methylphenyl)sulfonyloxypyrrolidine-1-carboxylate |
| InChIKey | MWACHFODPQVXHF-ZDUSSCGKSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O[C@H]2CCN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)