(S)-3-Amino-3-(3-isopropylphenyl)propanoic acid, 95%
cas: 1270210-02-0 — see every product listed under this CAS number, including other names
(S)-3-Amino-3-(3-isopropylphenyl)propanoic acid, 95% (CAS 1270210-02-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A808997-100mg |
| cas | 1270210-02-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 665.19 Pln | |
| Ambeed | 250mg | 1087.94 Pln | |
| Ambeed | 1g | 2801.19 Pln | |
| Chemat | 100mg | 611.60 Pln | |
| Chemat | 250mg | 1000.40 Pln | |
| Chemat | 1g | 2589.20 Pln | |
| BLDpharm | 100mg | 658.68 Pln | |
| BLDpharm | 250mg | 1069.65 Pln | |
| BLDpharm | 1g | 2746.84 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(3S)-3-amino-3-(3-propan-2-ylphenyl)propanoic acid (CAS 1270210-02-0) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: (3S)-3-amino-3-(3-propan-2-ylphenyl)propanoic acid. InChIKey: XYKOHTAQVPCTEE-NSHDSACASA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | (3S)-3-amino-3-(3-propan-2-ylphenyl)propanoic acid |
| InChIKey | XYKOHTAQVPCTEE-NSHDSACASA-N |
| SMILES | CC(C)C1=CC(=CC=C1)[C@H](CC(=O)O)N |
Computed by PubChem (NCBI)