cas: 228422-49-9 — see every product listed under this CAS number, including other names
(S)-3-Amino-3-(4-fluorophenyl)propan-1-ol 95% (CAS 228422-49-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A453243-100mg |
| cas | 228422-49-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 147.88 Pln | |
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 426.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A453243 |
(3S)-3-amino-3-(4-fluorophenyl)propan-1-ol (CAS 228422-49-9) is a chemical compound with the molecular formula C9H12FNO and a molecular weight of 169.20 g/mol. IUPAC name: (3S)-3-amino-3-(4-fluorophenyl)propan-1-ol. InChIKey: CCJPLYPJQZYBLI-VIFPVBQESA-N.
| Molecular formula | C9H12FNO |
|---|---|
| Molecular weight | 169.20 g/mol |
| IUPAC name | (3S)-3-amino-3-(4-fluorophenyl)propan-1-ol |
| InChIKey | CCJPLYPJQZYBLI-VIFPVBQESA-N |
| SMILES | C1=CC(=CC=C1[C@H](CCO)N)F |
Computed by PubChem (NCBI)