(S)-3-Amino-3-phenylpropionic acid, 97%
cas: 40856-44-8 — see every product listed under this CAS number, including other names
(S)-3-Amino-3-phenylpropionic acid, 97% (CAS 40856-44-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: BLDpharm, Fluorochem.
| brand | BLDpharm |
|---|---|
| catalog number | BD6812-250mg |
| cas | 40856-44-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 153.30 Pln | |
| BLDpharm | 10g | 169.96 Pln | |
| BLDpharm | 25g | 197.73 Pln | |
| BLDpharm | 100g | 419.88 Pln | |
| BLDpharm | 500g | 1802.72 Pln | |
| BLDpharm | 1kg | 3529.89 Pln | |
| Fluorochem | 1g | 102.06 Pln | |
| Fluorochem | 5g | 102.06 Pln | |
| Fluorochem | 10g | 107.27 Pln | |
| Fluorochem | 25g | 122.89 Pln | |
| Fluorochem | 100g | 242.64 Pln | |
| Fluorochem | 500g | 919.49 Pln | |
| Fluorochem | 1kg | 1757.73 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(S)-3-amino-3-phenylpropanoic acid is an optically active form of 3-amino-3-phenylpropanoic acid having S-configuration. It is an enantiomer of a (R)-3-amino-3-phenylpropanoic acid. It is a tautomer of a (S)-3-ammonio-3-phenylpropanoate.
Source: ChEBI
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 165.19 g/mol |
| IUPAC name | (3S)-3-amino-3-phenylpropanoic acid |
| InChIKey | UJOYFRCOTPUKAK-QMMMGPOBSA-N |
| SMILES | C1=CC=C(C=C1)[C@H](CC(=O)O)N |
Computed by PubChem (NCBI)