Products 66232-39-1

CAS 66232-39-1 is the registry number for 2-Methyl-6-(methylamino)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2-methyl-6-(methylamino)benzoic acid (CAS 66232-39-1) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. IUPAC name: 2-methyl-6-(methylamino)benzoic acid. InChIKey: LXBJMHFADIEJOC-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11NO2
Molecular weight165.19 g/mol
IUPAC name2-methyl-6-(methylamino)benzoic acid
InChIKeyLXBJMHFADIEJOC-UHFFFAOYSA-N
SMILESCC1=C(C(=CC=C1)NC)C(=O)O

Computed by PubChem (NCBI)