cas: 122536-72-5 — see every product listed under this CAS number, including other names
(S)-3-Amino-pyrrolidine-1-carboxylic acid benzyl ester, 97% (CAS 122536-72-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F087653-1G |
| cas | 122536-72-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 5g | 591.48 Pln | |
| Fluorochem | 10g | 1070.47 Pln | |
| Fluorochem | 25g | 1466.17 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Benzyl (3S)-3-aminopyrrolidine-1-carboxylate (CAS 122536-72-5) is a chemical compound with the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. IUPAC name: benzyl (3S)-3-aminopyrrolidine-1-carboxylate. InChIKey: FPXJNSKAXZNWMQ-NSHDSACASA-N.
| Molecular formula | C12H16N2O2 |
|---|---|
| Molecular weight | 220.27 g/mol |
| IUPAC name | benzyl (3S)-3-aminopyrrolidine-1-carboxylate |
| InChIKey | FPXJNSKAXZNWMQ-NSHDSACASA-N |
| SMILES | C1CN(C[C@H]1N)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)