CAS 897660-79-6 is the registry number for 5,5-Dimethyl-3-[(5-methylisoxazol-3-yl)amino]cyclohex-2-en-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
5,5-dimethyl-3-[(5-methyl-1,2-oxazol-3-yl)amino]cyclohex-2-en-1-one (CAS 897660-79-6) is a chemical compound with the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. IUPAC name: 5,5-dimethyl-3-[(5-methyl-1,2-oxazol-3-yl)amino]cyclohex-2-en-1-one. InChIKey: XWTNFBOFMHIMAT-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O2 |
|---|---|
| Molecular weight | 220.27 g/mol |
| IUPAC name | 5,5-dimethyl-3-[(5-methyl-1,2-oxazol-3-yl)amino]cyclohex-2-en-1-one |
| InChIKey | XWTNFBOFMHIMAT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NO1)NC2=CC(=O)CC(C2)(C)C |
Computed by PubChem (NCBI)