cas: 140645-24-5 — see every product listed under this CAS number, including other names
(S)-3-Aminomethyl-1-Boc-piperidine, 95% (CAS 140645-24-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F040637-1G |
| cas | 140645-24-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 294.71 Pln | |
| Fluorochem | 10g | 539.41 Pln | |
| Fluorochem | 25g | 1263.11 Pln | |
| Fluorochem | 100g | 4881.63 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl (3S)-3-(aminomethyl)piperidine-1-carboxylate (CAS 140645-24-5) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl (3S)-3-(aminomethyl)piperidine-1-carboxylate. InChIKey: WPWXYQIMXTUMJB-VIFPVBQESA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl (3S)-3-(aminomethyl)piperidine-1-carboxylate |
| InChIKey | WPWXYQIMXTUMJB-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](C1)CN |
Computed by PubChem (NCBI)