cas: 122709-21-1 — see every product listed under this CAS number, including other names
(S)-3-Boc-4-(Methoxymethylcarbamoyl)-2,2-dimethyloxazolidine 95% (CAS 122709-21-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A543029-250mg |
| cas | 122709-21-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 275.81 Pln | |
| Ambeed | 1g | 314.75 Pln | |
| Ambeed | 5g | 1037.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A543029 |
Tert-butyl (4S)-4-[methoxy(methyl)carbamoyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (CAS 122709-21-1) is a chemical compound with the molecular formula C13H24N2O5 and a molecular weight of 288.34 g/mol. IUPAC name: tert-butyl (4S)-4-[methoxy(methyl)carbamoyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate. InChIKey: USINQMZZDNKSQW-VIFPVBQESA-N.
| Molecular formula | C13H24N2O5 |
|---|---|
| Molecular weight | 288.34 g/mol |
| IUPAC name | tert-butyl (4S)-4-[methoxy(methyl)carbamoyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| InChIKey | USINQMZZDNKSQW-VIFPVBQESA-N |
| SMILES | CC1(N([C@@H](CO1)C(=O)N(C)OC)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)