CAS 139601-17-5 is the registry number for D-Valine, n-[(1,1-dimethylethoxy)carbonyl]-l-alanyl-, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
(2R)-3-methyl-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]butanoic acid (CAS 139601-17-5) is a chemical compound with the molecular formula C13H24N2O5 and a molecular weight of 288.34 g/mol. IUPAC name: (2R)-3-methyl-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]butanoic acid. InChIKey: RXWAYSHEJZXKQQ-DTWKUNHWSA-N.
| Molecular formula | C13H24N2O5 |
|---|---|
| Molecular weight | 288.34 g/mol |
| IUPAC name | (2R)-3-methyl-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]butanoic acid |
| InChIKey | RXWAYSHEJZXKQQ-DTWKUNHWSA-N |
| SMILES | C[C@@H](C(=O)N[C@H](C(C)C)C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)