cas: 216854-23-8 — see every product listed under this CAS number, including other names
(S)-3-N-Boc-aminopiperidine, 98%, 98% (CAS 216854-23-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1143H7-1g |
| cas | 216854-23-8 |
| size | 1g |
| availability | 891g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 98.00 Pln | |
| Chemat | 25g | 136.40 Pln | |
| Chemat | 100g | 366.80 Pln | |
| Chemat | 500g | 1656.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(3S)-piperidin-3-yl]carbamate (CAS 216854-23-8) is a chemical compound with the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. IUPAC name: tert-butyl N-[(3S)-piperidin-3-yl]carbamate. InChIKey: WUOQXNWMYLFAHT-QMMMGPOBSA-N.
| Molecular formula | C10H20N2O2 |
|---|---|
| Molecular weight | 200.28 g/mol |
| IUPAC name | tert-butyl N-[(3S)-piperidin-3-yl]carbamate |
| InChIKey | WUOQXNWMYLFAHT-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCNC1 |
Computed by PubChem (NCBI)