cas: 176970-12-0 — see every product listed under this CAS number, including other names
(S)-3-N-Cbz-aminopyrrolidine 97% (CAS 176970-12-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A113915-100mg |
| cas | 176970-12-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 192.38 Pln | |
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 359.25 Pln | |
| Ambeed | 5g | 1037.88 Pln | |
| Ambeed | 10g | 1594.12 Pln | |
| Ambeed | 25g | 3118.25 Pln | |
| Ambeed | 100g | 9826.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A113915 |
Benzyl N-[(3S)-pyrrolidin-3-yl]carbamate (CAS 176970-12-0) is a chemical compound with the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. IUPAC name: benzyl N-[(3S)-pyrrolidin-3-yl]carbamate. InChIKey: DSOICHFMGRBFCM-NSHDSACASA-N.
| Molecular formula | C12H16N2O2 |
|---|---|
| Molecular weight | 220.27 g/mol |
| IUPAC name | benzyl N-[(3S)-pyrrolidin-3-yl]carbamate |
| InChIKey | DSOICHFMGRBFCM-NSHDSACASA-N |
| SMILES | C1CNC[C@H]1NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)