cas: 59349-71-2 — see every product listed under this CAS number, including other names
(S)-3-Phenylpiperidine, 97%, 97% (CAS 59349-71-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EAQC-100mg |
| cas | 59349-71-2 |
| size | 100mg |
| availability | 5.4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 405.20 Pln | |
| Chemat | 250mg | 654.80 Pln | |
| Chemat | 1g | 1667.60 Pln | |
| Chemat | 5g | 5051.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3S)-3-phenylpiperidine (CAS 59349-71-2) is a chemical compound with the molecular formula C11H15N and a molecular weight of 161.24 g/mol. IUPAC name: (3S)-3-phenylpiperidine. InChIKey: NZYBILDYPCVNMU-LLVKDONJSA-N.
| Molecular formula | C11H15N |
|---|---|
| Molecular weight | 161.24 g/mol |
| IUPAC name | (3S)-3-phenylpiperidine |
| InChIKey | NZYBILDYPCVNMU-LLVKDONJSA-N |
| SMILES | C1C[C@H](CNC1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)