cas: 207924-92-3 — see every product listed under this CAS number, including other names
(S)-4-((tert-Butoxycarbonyl)amino)pentanoic acid, 97% (CAS 207924-92-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F211009-100MG |
| cas | 207924-92-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 216.61 Pln | |
| Fluorochem | 250mg | 279.09 Pln | |
| Fluorochem | 1g | 607.10 Pln | |
| Fluorochem | 5g | 2262.76 Pln | |
| Fluorochem | 10g | 4189.17 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 207924-92-3) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: (4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: CVYVXURBKURNKE-ZETCQYMHSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | (4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | CVYVXURBKURNKE-ZETCQYMHSA-N |
| SMILES | C[C@@H](CCC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)