Products 1402851-52-8
CAS 1402851-52-8 appears in our catalog under these names: (S)-tBu-iQuinox, 97% 99%ee, 97% 99%ee, (S)-4-(tert-Butyl)-2-(isoquinolin-1-yl)-4,5-dihydrooxazole, 98%, (S)-4-(tert-Butyl)-2-(isoquinolin-1-yl)-4,5-dihydrooxazole, 97% 99%ee. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg.
(4S)-4-tert-butyl-2-isoquinolin-1-yl-4,5-dihydro-1,3-oxazole (CAS 1402851-52-8) is a chemical compound with the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. IUPAC name: (4S)-4-tert-butyl-2-isoquinolin-1-yl-4,5-dihydro-1,3-oxazole. InChIKey: YFSNGZCIVOUXHS-CYBMUJFWSA-N.
| Molecular formula | C16H18N2O |
|---|---|
| Molecular weight | 254.33 g/mol |
| IUPAC name | (4S)-4-tert-butyl-2-isoquinolin-1-yl-4,5-dihydro-1,3-oxazole |
| InChIKey | YFSNGZCIVOUXHS-CYBMUJFWSA-N |
| SMILES | CC(C)(C)[C@H]1COC(=N1)C2=NC=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)