CAS 19618-11-2 is the registry number for 2,2',3,3'-Tetramethylazoxybenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg.
(2,3-dimethylphenyl)-(2,3-dimethylphenyl)imino-oxidoazanium (CAS 19618-11-2) is a chemical compound with the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. IUPAC name: (2,3-dimethylphenyl)-(2,3-dimethylphenyl)imino-oxidoazanium. InChIKey: OFXNOPZTUPYCDA-UHFFFAOYSA-N.
| Molecular formula | C16H18N2O |
|---|---|
| Molecular weight | 254.33 g/mol |
| IUPAC name | (2,3-dimethylphenyl)-(2,3-dimethylphenyl)imino-oxidoazanium |
| InChIKey | OFXNOPZTUPYCDA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)N=[N+](C2=CC=CC(=C2C)C)[O-])C |
Computed by PubChem (NCBI)