cas: 714971-28-5 — see every product listed under this CAS number, including other names
(S)-4-Boc-(3-hydroxymethyl)morpholine, 97% (CAS 714971-28-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F093774-250MG |
| cas | 714971-28-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 122.89 Pln | |
| Fluorochem | 1g | 143.72 Pln | |
| Fluorochem | 5g | 279.09 Pln | |
| Fluorochem | 10g | 476.93 Pln | |
| Fluorochem | 25g | 877.83 Pln | |
| Fluorochem | 100g | 2825.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
Tert-butyl (3S)-3-(hydroxymethyl)morpholine-4-carboxylate (CAS 714971-28-5) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: tert-butyl (3S)-3-(hydroxymethyl)morpholine-4-carboxylate. InChIKey: AIQSXVGBMCJQAG-QMMMGPOBSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | tert-butyl (3S)-3-(hydroxymethyl)morpholine-4-carboxylate |
| InChIKey | AIQSXVGBMCJQAG-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOC[C@@H]1CO |
Computed by PubChem (NCBI)