cas: 1213519-46-0 — see every product listed under this CAS number, including other names
(S)-4-Fluoro-2,3-dihydrobenzofuran-3-amine, 97% (CAS 1213519-46-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F695461-100MG |
| cas | 1213519-46-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 351.98 Pln | |
| Fluorochem | 250mg | 737.26 Pln | |
| Fluorochem | 1g | 2106.57 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(3S)-4-fluoro-2,3-dihydro-1-benzofuran-3-amine (CAS 1213519-46-0) is a chemical compound with the molecular formula C8H8FNO and a molecular weight of 153.15 g/mol. IUPAC name: (3S)-4-fluoro-2,3-dihydro-1-benzofuran-3-amine. InChIKey: AQQJRPFPRCBKNR-ZCFIWIBFSA-N.
| Molecular formula | C8H8FNO |
|---|---|
| Molecular weight | 153.15 g/mol |
| IUPAC name | (3S)-4-fluoro-2,3-dihydro-1-benzofuran-3-amine |
| InChIKey | AQQJRPFPRCBKNR-ZCFIWIBFSA-N |
| SMILES | C1[C@H](C2=C(O1)C=CC=C2F)N |
Computed by PubChem (NCBI)