Products 105655-00-3

CAS 105655-00-3 is the registry number for 6-Fluoro-3,4-dihydro-2h-benzo[1,4]oxazine, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g, 10g, 250mg.

Structural formula: {0} (CAS {1})

6-fluoro-3,4-dihydro-2H-1,4-benzoxazine (CAS 105655-00-3) is a chemical compound with the molecular formula C8H8FNO and a molecular weight of 153.15 g/mol. IUPAC name: 6-fluoro-3,4-dihydro-2H-1,4-benzoxazine. InChIKey: FQKORLPTBCMNGR-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8FNO
Molecular weight153.15 g/mol
IUPAC name6-fluoro-3,4-dihydro-2H-1,4-benzoxazine
InChIKeyFQKORLPTBCMNGR-UHFFFAOYSA-N
SMILESC1COC2=C(N1)C=C(C=C2)F

Computed by PubChem (NCBI)