cas: 184346-45-0 — see every product listed under this CAS number, including other names
(S)-4-Isopropyl-5,5-diphenyloxazolidin-2-one, 97% (CAS 184346-45-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2.5g, 5g, 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F986496-1G |
| cas | 184346-45-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 263.47 Pln | |
| Fluorochem | 2.5g | 482.14 Pln | |
| Fluorochem | 5g | 763.29 Pln | |
| Fluorochem | 100mg | 107.27 Pln | |
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 253.05 Pln | |
| Fluorochem | 5g | 810.15 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(4S)-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one (CAS 184346-45-0) is a chemical compound with the molecular formula C18H19NO2 and a molecular weight of 281.3 g/mol. IUPAC name: (4S)-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one. InChIKey: PHTOJBANGYSTOH-INIZCTEOSA-N.
| Molecular formula | C18H19NO2 |
|---|---|
| Molecular weight | 281.3 g/mol |
| IUPAC name | (4S)-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one |
| InChIKey | PHTOJBANGYSTOH-INIZCTEOSA-N |
| SMILES | CC(C)[C@H]1C(OC(=O)N1)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)