CAS 1125430-43-4 is the registry number for 4-[4-(Piperidine-1-carbonyl)phenyl]phenol, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
[4-(4-hydroxyphenyl)phenyl]-piperidin-1-ylmethanone (CAS 1125430-43-4) is a chemical compound with the molecular formula C18H19NO2 and a molecular weight of 281.3 g/mol. IUPAC name: [4-(4-hydroxyphenyl)phenyl]-piperidin-1-ylmethanone. InChIKey: QOQODQYWGUOWCJ-UHFFFAOYSA-N.
| Molecular formula | C18H19NO2 |
|---|---|
| Molecular weight | 281.3 g/mol |
| IUPAC name | [4-(4-hydroxyphenyl)phenyl]-piperidin-1-ylmethanone |
| InChIKey | QOQODQYWGUOWCJ-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)C2=CC=C(C=C2)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)