cas: 625843-74-5 — see every product listed under this CAS number, including other names
(S)-4-N-Trityl-2-methyl-piperazine, 98% (CAS 625843-74-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F011907-250MG |
| cas | 625843-74-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 1g | 351.98 Pln | |
| Fluorochem | 5g | 1028.82 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(3S)-3-methyl-1-tritylpiperazine (CAS 625843-74-5) is a chemical compound with the molecular formula C24H26N2 and a molecular weight of 342.5 g/mol. IUPAC name: (3S)-3-methyl-1-tritylpiperazine. InChIKey: VYUQPZHRDKLOPX-FQEVSTJZSA-N.
| Molecular formula | C24H26N2 |
|---|---|
| Molecular weight | 342.5 g/mol |
| IUPAC name | (3S)-3-methyl-1-tritylpiperazine |
| InChIKey | VYUQPZHRDKLOPX-FQEVSTJZSA-N |
| SMILES | C[C@H]1CN(CCN1)C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)