CAS 313657-75-9 is the registry number for (R)-4-N-Trityl-2-methyl piperazine, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
(3R)-3-methyl-1-tritylpiperazine (CAS 313657-75-9) is a chemical compound with the molecular formula C24H26N2 and a molecular weight of 342.5 g/mol. IUPAC name: (3R)-3-methyl-1-tritylpiperazine. InChIKey: VYUQPZHRDKLOPX-HXUWFJFHSA-N.
| Molecular formula | C24H26N2 |
|---|---|
| Molecular weight | 342.5 g/mol |
| IUPAC name | (3R)-3-methyl-1-tritylpiperazine |
| InChIKey | VYUQPZHRDKLOPX-HXUWFJFHSA-N |
| SMILES | C[C@@H]1CN(CCN1)C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)