cas: 1129634-44-1 — see every product listed under this CAS number, including other names
(S)-5-(tert-Butoxycarbonyl)-5-azaspiro[2.4]heptane-6-carboxylic acid, 98%, 98% (CAS 1129634-44-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 50g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1140JE-1g |
| cas | 1129634-44-1 |
| size | 1g |
| availability | 410.77g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 136.40 Pln | |
| Chemat | 25g | 242.00 Pln | |
| Chemat | 100g | 770.00 Pln | |
| Chemat | 50g | 419.60 Pln | |
| Chemat | 250g | 1835.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(6S)-5-[(2-methylpropan-2-yl)oxycarbonyl]-5-azaspiro[2.4]heptane-6-carboxylic acid (CAS 1129634-44-1) is a chemical compound with the molecular formula C12H19NO4 and a molecular weight of 241.28 g/mol. IUPAC name: (6S)-5-[(2-methylpropan-2-yl)oxycarbonyl]-5-azaspiro[2.4]heptane-6-carboxylic acid. InChIKey: VEIYKHIPSJIVRK-QMMMGPOBSA-N.
| Molecular formula | C12H19NO4 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | (6S)-5-[(2-methylpropan-2-yl)oxycarbonyl]-5-azaspiro[2.4]heptane-6-carboxylic acid |
| InChIKey | VEIYKHIPSJIVRK-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(CC2)C[C@H]1C(=O)O |
Computed by PubChem (NCBI)