cas: 903557-29-9 — see every product listed under this CAS number, including other names
(S)-5-Bromo-2,3-dihydro-1H-inden-1-amine, 98% (CAS 903557-29-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F217059-100MG |
| cas | 903557-29-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 690.40 Pln | |
| Fluorochem | 250mg | 1002.79 Pln | |
| Fluorochem | 1g | 2424.16 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(1S)-5-bromo-2,3-dihydro-1H-inden-1-amine (CAS 903557-29-9) is a chemical compound with the molecular formula C9H10BrN and a molecular weight of 212.09 g/mol. IUPAC name: (1S)-5-bromo-2,3-dihydro-1H-inden-1-amine. InChIKey: IEUKCNPRRGOGDG-VIFPVBQESA-N.
| Molecular formula | C9H10BrN |
|---|---|
| Molecular weight | 212.09 g/mol |
| IUPAC name | (1S)-5-bromo-2,3-dihydro-1H-inden-1-amine |
| InChIKey | IEUKCNPRRGOGDG-VIFPVBQESA-N |
| SMILES | C1CC2=C([C@H]1N)C=CC(=C2)Br |
Computed by PubChem (NCBI)