(S)-5-Methyl-2,3-dihydro-1H-inden-1-amine hydrochloride, 95% HPLC
cas: 2322935-77-1 — see every product listed under this CAS number, including other names
(S)-5-Methyl-2,3-dihydro-1H-inden-1-amine hydrochloride, 95% HPLC (CAS 2322935-77-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1538932-250mg |
| cas | 2322935-77-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1588.56 Pln | |
| Ambeed | 1g | 4158.44 Pln | |
| BLDpharm | 100mg | 1036.33 Pln | |
| BLDpharm | 250mg | 1708.31 Pln | |
| BLDpharm | 1g | 4479.56 Pln | |
| Chemat | 100mg | 938.00 Pln | |
| Chemat | 250mg | 1547.60 Pln | |
| Chemat | 1g | 4072.40 Pln | |
| Fluorochem | 100mg | 1731.70 Pln | |
| Fluorochem | 250mg | 2882.34 Pln |
properties
| purity | 95% HPLC |
|---|---|
| delivery time | 2-3 weeks |
(1S)-5-methyl-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 2322935-77-1) is a chemical compound with the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. IUPAC name: (1S)-5-methyl-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: QRNAPASFAPDYJC-PPHPATTJSA-N.
| Molecular formula | C10H14ClN |
|---|---|
| Molecular weight | 183.68 g/mol |
| IUPAC name | (1S)-5-methyl-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | QRNAPASFAPDYJC-PPHPATTJSA-N |
| SMILES | CC1=CC2=C(C=C1)[C@H](CC2)N.Cl |
Computed by PubChem (NCBI)