Products 2172473-99-1
CAS 2172473-99-1 appears in our catalog under these names: 4-(1-Methylcyclopropyl)aniline hydrochloride, 4-(1-methylcyclopropyl)aniline hydrochloride, 95%, 4-(1-Methylcyclopropyl)aniline hydrochloride 98%, 4-(1-Methylcyclopropyl)aniline hydrochloride, 98%, 98%. Offered by: Biosynth, Combi-blocks, Ambeed, Chemat. Available pack sizes: 50mg, 0,5g, 1g, 250mg, 100mg, 5g.
4-(1-methylcyclopropyl)aniline;hydrochloride (CAS 2172473-99-1) is a chemical compound with the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. IUPAC name: 4-(1-methylcyclopropyl)aniline;hydrochloride. InChIKey: AXEHZAXXZVCVEO-UHFFFAOYSA-N.
| Molecular formula | C10H14ClN |
|---|---|
| Molecular weight | 183.68 g/mol |
| IUPAC name | 4-(1-methylcyclopropyl)aniline;hydrochloride |
| InChIKey | AXEHZAXXZVCVEO-UHFFFAOYSA-N |
| SMILES | CC1(CC1)C2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)