(S)-6-(((tert-Butyldimethylsilyl)oxy)methyl)-5,6-dihydro-2H-pyran-2-one, 97%
cas: 527742-73-0 — see every product listed under this CAS number, including other names
(S)-6-(((tert-Butyldimethylsilyl)oxy)methyl)-5,6-dihydro-2H-pyran-2-one, 97% (CAS 527742-73-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A2887742-100mg |
| cas | 527742-73-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 442.69 Pln | |
| Ambeed | 250mg | 693.00 Pln | |
| Ambeed | 1g | 1755.44 Pln | |
| Ambeed | 5g | 4976.12 Pln | |
| BLDpharm | 100mg | 469.86 Pln | |
| BLDpharm | 250mg | 741.99 Pln | |
| BLDpharm | 1g | 1886.03 Pln | |
| BLDpharm | 5g | 5357.03 Pln | |
| Chemat | 100mg | 434.00 Pln | |
| Chemat | 250mg | 688.40 Pln | |
| Chemat | 1g | 1754.00 Pln | |
| Chemat | 5g | 4998.80 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
(2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dihydropyran-6-one (CAS 527742-73-0) is a chemical compound with the molecular formula C12H22O3Si and a molecular weight of 242.39 g/mol. IUPAC name: (2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dihydropyran-6-one. InChIKey: JSQWZBVWCJWLKC-JTQLQIEISA-N.
| Molecular formula | C12H22O3Si |
|---|---|
| Molecular weight | 242.39 g/mol |
| IUPAC name | (2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dihydropyran-6-one |
| InChIKey | JSQWZBVWCJWLKC-JTQLQIEISA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1CC=CC(=O)O1 |
Computed by PubChem (NCBI)