CAS 527742-73-0 appears in our catalog under these names: (S)-6-(((tert-Butyldimethylsilyl)oxy)methyl)-5,6-dihydro-2H-pyran-2-one, 97%, 97%, (S)-6-(((tert-Butyldimethylsilyl)oxy)methyl)-5,6-dihydro-2H-pyran-2-one, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dihydropyran-6-one (CAS 527742-73-0) is a chemical compound with the molecular formula C12H22O3Si and a molecular weight of 242.39 g/mol. IUPAC name: (2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dihydropyran-6-one. InChIKey: JSQWZBVWCJWLKC-JTQLQIEISA-N.
| Molecular formula | C12H22O3Si |
|---|---|
| Molecular weight | 242.39 g/mol |
| IUPAC name | (2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dihydropyran-6-one |
| InChIKey | JSQWZBVWCJWLKC-JTQLQIEISA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1CC=CC(=O)O1 |
Computed by PubChem (NCBI)