cas: 1213547-18-2 — see every product listed under this CAS number, including other names
(S)-6-Bromo-1,2,3,4-tetrahydronaphthalen-1-amine, 95% (CAS 1213547-18-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F546683-50MG |
| cas | 1213547-18-2 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 544.62 Pln | |
| Fluorochem | 100mg | 976.76 Pln | |
| Fluorochem | 250mg | 2153.43 Pln | |
| Fluorochem | 1g | 6318.63 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(1S)-6-bromo-1,2,3,4-tetrahydronaphthalen-1-amine (CAS 1213547-18-2) is a chemical compound with the molecular formula C10H12BrN and a molecular weight of 226.11 g/mol. IUPAC name: (1S)-6-bromo-1,2,3,4-tetrahydronaphthalen-1-amine. InChIKey: JBGXAYOORBASGV-JTQLQIEISA-N.
| Molecular formula | C10H12BrN |
|---|---|
| Molecular weight | 226.11 g/mol |
| IUPAC name | (1S)-6-bromo-1,2,3,4-tetrahydronaphthalen-1-amine |
| InChIKey | JBGXAYOORBASGV-JTQLQIEISA-N |
| SMILES | C1C[C@@H](C2=C(C1)C=C(C=C2)Br)N |
Computed by PubChem (NCBI)