cas: 1212307-91-9 — see every product listed under this CAS number, including other names
(S)-Benzyl 3-formylpyrrolidine-1-carboxylate 95% (CAS 1212307-91-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A166293-100mg |
| cas | 1212307-91-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 715.25 Pln | |
| Ambeed | 250mg | 1160.25 Pln | |
| Ambeed | 1g | 3007.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A166293 |
Benzyl (3S)-3-formylpyrrolidine-1-carboxylate (CAS 1212307-91-9) is a chemical compound with the molecular formula C13H15NO3 and a molecular weight of 233.26 g/mol. IUPAC name: benzyl (3S)-3-formylpyrrolidine-1-carboxylate. InChIKey: GDPSCBPOCONUDM-LBPRGKRZSA-N.
| Molecular formula | C13H15NO3 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | benzyl (3S)-3-formylpyrrolidine-1-carboxylate |
| InChIKey | GDPSCBPOCONUDM-LBPRGKRZSA-N |
| SMILES | C1CN(C[C@H]1C=O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)