cas: 72776-05-7 — see every product listed under this CAS number, including other names
(S)-Benzyl 4-oxoazetidine-2-carboxylate, 97% (CAS 72776-05-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F219752-100MG |
| cas | 72776-05-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 258.26 Pln | |
| Fluorochem | 250mg | 362.39 Pln | |
| Fluorochem | 1g | 700.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Benzyl (2S)-4-oxoazetidine-2-carboxylate (CAS 72776-05-7) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: benzyl (2S)-4-oxoazetidine-2-carboxylate. InChIKey: WGLLBHSIXLWVFU-VIFPVBQESA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | benzyl (2S)-4-oxoazetidine-2-carboxylate |
| InChIKey | WGLLBHSIXLWVFU-VIFPVBQESA-N |
| SMILES | C1[C@H](NC1=O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)