CAS 145591-80-6 appears in our catalog under these names: 1-(Phenylcarbamoyl)cyclopropane-1-carboxylic acid, 95%, Cabozantinib Impurity 1, 1–(phenylcarbamoyl)cyclopropane–1–carboxylic acid, 1-(Phenylcarbamoyl)cyclopropanecarboxylic acid, Cyclopropanecarboxylic acid, 1-[(phenylamino)carbonyl]-, 95%, 95%. Offered by: Combi-blocks, Chemat Brand, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 100mg, 250mg, on request.
1-(phenylcarbamoyl)cyclopropane-1-carboxylic acid (CAS 145591-80-6) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: 1-(phenylcarbamoyl)cyclopropane-1-carboxylic acid. InChIKey: KDXROTVXLGAFGW-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 1-(phenylcarbamoyl)cyclopropane-1-carboxylic acid |
| InChIKey | KDXROTVXLGAFGW-UHFFFAOYSA-N |
| SMILES | C1CC1(C(=O)NC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)