cas: 180468-42-2 — see every product listed under this CAS number, including other names
(S)-Ethyl-1-phenyl-3,4-dihydroisoquinoline-2(1H)-carboxylate (CAS 180468-42-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11331Y-50mg |
| cas | 180468-42-2 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 318.80 Pln | |
| Chemat | 250mg | 957.20 Pln | |
| Chemat | 1g | 2627.60 Pln |
| delivery time | 3 weeks |
|---|
Ethyl (1S)-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate (CAS 180468-42-2) is a chemical compound with the molecular formula C18H19NO2 and a molecular weight of 281.3 g/mol. IUPAC name: ethyl (1S)-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate. InChIKey: DKKVDRQVNMALLN-KRWDZBQOSA-N.
| Molecular formula | C18H19NO2 |
|---|---|
| Molecular weight | 281.3 g/mol |
| IUPAC name | ethyl (1S)-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| InChIKey | DKKVDRQVNMALLN-KRWDZBQOSA-N |
| SMILES | CCOC(=O)N1CCC2=CC=CC=C2[C@@H]1C3=CC=CC=C3 |
Computed by PubChem (NCBI)